Products 97548-97-5
CAS 97548-97-5 appears in our catalog under these names: Quinelorane Dihydrochloride, Quinelorane hydrochloride, Quinelorane (dihydrochloride), 99%, 99%, Quinelorane (dihydrochloride), 99.0%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 500mg, 10mg, 1mg, 5mg, 5 mg.
(5aR,9aR)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine;dihydrochloride (CAS 97548-97-5) is a chemical compound with the molecular formula C14H24Cl2N4 and a molecular weight of 319.3 g/mol. IUPAC name: (5aR,9aR)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine;dihydrochloride. InChIKey: WDEMLQIGYYLRRX-OWVUFADGSA-N.
| Molecular formula | C14H24Cl2N4 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | (5aR,9aR)-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinazolin-2-amine;dihydrochloride |
| InChIKey | WDEMLQIGYYLRRX-OWVUFADGSA-N |
| SMILES | CCCN1CCC[C@H]2[C@H]1CC3=CN=C(N=C3C2)N.Cl.Cl |
Computed by PubChem (NCBI)