CAS 976-56-7 appears in our catalog under these names: Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate, 98%, Irganox 1222, Diethyl 3,5-Di-tert-butyl-4-hydroxybenzylphosphonate, >98.0%(HPLC), Diethyl 3,5-di-tert-butyl-4-hydroxybenzylphosphonate 98%, Diethyl 3,5-Di-Tert-Butyl-4-Hydroxybenzylphosphonate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 500g, 100g, 1000g, 1kg.
2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol (CAS 976-56-7) is a chemical compound with the molecular formula C19H33O4P and a molecular weight of 356.4 g/mol. IUPAC name: 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol. InChIKey: GJDRKHHGPHLVNI-UHFFFAOYSA-N.
| Molecular formula | C19H33O4P |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol |
| InChIKey | GJDRKHHGPHLVNI-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)OCC |
Computed by PubChem (NCBI)