Products 97604-59-6
CAS 97604-59-6 is the registry number for Methyl 2-azido-3,4,6-tri-O-acetyl-2-deoxy-b-D-mannopyranoside. Offered by: Biosynth. Available pack sizes: 50mg, 5mg.
[(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-azido-6-methoxyoxan-2-yl]methyl acetate (CAS 97604-59-6) is a chemical compound with the molecular formula C13H19N3O8 and a molecular weight of 345.31 g/mol. IUPAC name: [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-azido-6-methoxyoxan-2-yl]methyl acetate. InChIKey: KXUDSQPSDRNDFJ-NZEXEKPDSA-N.
| Molecular formula | C13H19N3O8 |
|---|---|
| Molecular weight | 345.31 g/mol |
| IUPAC name | [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-azido-6-methoxyoxan-2-yl]methyl acetate |
| InChIKey | KXUDSQPSDRNDFJ-NZEXEKPDSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)OC)N=[N+]=[N-])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)