CAS 97630-12-1 is the registry number for 1-((3,5-Bis(trifluoromethyl)phenyl)sulfonyl)piperazine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride (CAS 97630-12-1) is a chemical compound with the molecular formula C12H13ClF6N2O2S and a molecular weight of 398.75 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride. InChIKey: LREFTIFOIBSXDQ-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF6N2O2S |
|---|---|
| Molecular weight | 398.75 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride |
| InChIKey | LREFTIFOIBSXDQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)