CAS 97657-92-6 appears in our catalog under these names: Latrepirdine DiHCl, Latrepirdine Dihydrochloride, Latrepirdine 2HCl, 98%, Latrepirdine dihydrochloride/ 98.45% (existing batch purity), Latrepirdine dihydrochloride. Offered by: Chemat Brand, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: on request, 500mg, 10mg, 5mg, 2mg, 10mM (in 1ml dmso), 50mg, 25mg.
2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride (CAS 97657-92-6) is a chemical compound with the molecular formula C21H27Cl2N3 and a molecular weight of 392.4 g/mol. IUPAC name: 2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride. InChIKey: GTWLIQOLGOZTLF-UHFFFAOYSA-N.
| Molecular formula | C21H27Cl2N3 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;dihydrochloride |
| InChIKey | GTWLIQOLGOZTLF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CN=C(C=C4)C.Cl.Cl |
Computed by PubChem (NCBI)