CAS 97744-89-3 appears in our catalog under these names: 6,7-Methylenedioxy-4-isocyanatomethylcoumarin, 95%, 6,7–Methylenedioxy–4–isocyanatomethylcoumarin (for HPLC Labeling). Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg.
8-(isocyanatomethyl)-[1,3]dioxolo[4,5-g]chromen-6-one (CAS 97744-89-3) is a chemical compound with the molecular formula C12H7NO5 and a molecular weight of 245.19 g/mol. IUPAC name: 8-(isocyanatomethyl)-[1,3]dioxolo[4,5-g]chromen-6-one. InChIKey: WIZBKPDCGYLOMY-UHFFFAOYSA-N.
| Molecular formula | C12H7NO5 |
|---|---|
| Molecular weight | 245.19 g/mol |
| IUPAC name | 8-(isocyanatomethyl)-[1,3]dioxolo[4,5-g]chromen-6-one |
| InChIKey | WIZBKPDCGYLOMY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=CC(=O)O3)CN=C=O |
Computed by PubChem (NCBI)