CAS 97772-96-8 is the registry number for N-(4-Aminobenzoyl)-L-glutamic acid monosodium salt, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Sodium;(2S)-2-[(4-aminobenzoyl)amino]pentanedioate;hydron (CAS 97772-96-8) is a chemical compound with the molecular formula C12H13N2NaO5 and a molecular weight of 288.23 g/mol. IUPAC name: sodium;(2S)-2-[(4-aminobenzoyl)amino]pentanedioate;hydron. InChIKey: QTFDQUUWYNVHIJ-FVGYRXGTSA-M.
| Molecular formula | C12H13N2NaO5 |
|---|---|
| Molecular weight | 288.23 g/mol |
| IUPAC name | sodium;(2S)-2-[(4-aminobenzoyl)amino]pentanedioate;hydron |
| InChIKey | QTFDQUUWYNVHIJ-FVGYRXGTSA-M |
| SMILES | [H+].C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])N.[Na+] |
Computed by PubChem (NCBI)