CAS 97772-99-1 is the registry number for 7-Hydroxy Aminopterin. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
(2S)-2-[[4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid (CAS 97772-99-1) is a chemical compound with the molecular formula C19H20N8O6 and a molecular weight of 456.4 g/mol. IUPAC name: (2S)-2-[[4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid. InChIKey: KTRAZHHNSREJAS-JTQLQIEISA-N.
| Molecular formula | C19H20N8O6 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | (2S)-2-[[4-[(2,4-diamino-7-oxo-8H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | KTRAZHHNSREJAS-JTQLQIEISA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2=NC3=C(N=C(N=C3NC2=O)N)N |
Computed by PubChem (NCBI)