CAS 97845-60-8 appears in our catalog under these names: Famciclovir Impurity 15, 9-(4-Acetoxy-3-(acetoxymethyl)butyl)-2-amino-6-chloropurine, 2–(2–(2–Amino–6–chloro–9H–purin–9–yl)ethyl)propane–1,3–diyl diacetate, Famciclovir Chloro Impurity 95%, 6-CHLORO FAMCICLOVIR. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 10g, 1g, 4x25mg, 25mg, 100g, 25g, 5g.
[2-(acetyloxymethyl)-4-(2-amino-6-chloropurin-9-yl)butyl] acetate (CAS 97845-60-8) is a chemical compound with the molecular formula C14H18ClN5O4 and a molecular weight of 355.78 g/mol. IUPAC name: [2-(acetyloxymethyl)-4-(2-amino-6-chloropurin-9-yl)butyl] acetate. InChIKey: KXPSHSVVYGZKAV-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN5O4 |
|---|---|
| Molecular weight | 355.78 g/mol |
| IUPAC name | [2-(acetyloxymethyl)-4-(2-amino-6-chloropurin-9-yl)butyl] acetate |
| InChIKey | KXPSHSVVYGZKAV-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(CCN1C=NC2=C1N=C(N=C2Cl)N)COC(=O)C |
Computed by PubChem (NCBI)