Products 97888-80-7
CAS 97888-80-7 appears in our catalog under these names: 4-Benzyloxy-3,5-dimethylbenzoic acid, 96%, 4-Benzyloxy-3,5-dimethylbenzoic acid, 98%, 4-Benzyloxy-3,5-dimethylbenzoic acid, 98+% , 4-Benzyloxy-3,5-dimethylbenzoic acid, 4-Benzyloxy-3,5-dimethylbenzoic acid 98%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 5g, 1g, 25g, 2g.
3,5-dimethyl-4-phenylmethoxybenzoic acid (CAS 97888-80-7) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 3,5-dimethyl-4-phenylmethoxybenzoic acid. InChIKey: JABUPJCJZZNUFK-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 3,5-dimethyl-4-phenylmethoxybenzoic acid |
| InChIKey | JABUPJCJZZNUFK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCC2=CC=CC=C2)C)C(=O)O |
Computed by PubChem (NCBI)