Products 97908-71-9

CAS 97908-71-9 is the registry number for Tenofovir Impurity 58 ((N1,N3-15N2)) Adenine. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7H-purin-6-amine (CAS 97908-71-9) is a chemical compound with the molecular formula C5H5N5 and a molecular weight of 137.11 g/mol. IUPAC name: 7H-purin-6-amine. InChIKey: GFFGJBXGBJISGV-GAWGKFCISA-N.

Identity
Molecular formulaC5H5N5
Molecular weight137.11 g/mol
IUPAC name7H-purin-6-amine
InChIKeyGFFGJBXGBJISGV-GAWGKFCISA-N
SMILESC1=NC2=[15N]C=[15N]C(=C2N1)N

Computed by PubChem (NCBI)