CAS 97941-91-8 appears in our catalog under these names: 2-Chloro-N,N-dimethylethylamine-d6 Hydrochloride, 2-Chloro-N,N-dimethyl-d6-ethylamine HCl, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN, Biosynth. Available pack sizes: 100mg, 10mg, 0,5g, 0,25g, 50mg.
2-chloro-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride (CAS 97941-91-8) is a chemical compound with the molecular formula C4H11Cl2N and a molecular weight of 150.08 g/mol. IUPAC name: 2-chloro-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride. InChIKey: LQLJZSJKRYTKTP-TXHXQZCNSA-N.
| Molecular formula | C4H11Cl2N |
|---|---|
| Molecular weight | 150.08 g/mol |
| IUPAC name | 2-chloro-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride |
| InChIKey | LQLJZSJKRYTKTP-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCl)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)