CAS 97945-19-2 appears in our catalog under these names: Trans-2-amino-4-cyclohexene-1-carboxylic acid, 95%, 6-Aminocyclohex-3-enecarboxylic acid hydrochloride, 98%, trans-6-Aminocyclohex-3-ene-1-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, 250mg, on request.
(1R,6R)-6-aminocyclohex-3-ene-1-carboxylic acid (CAS 97945-19-2) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: (1R,6R)-6-aminocyclohex-3-ene-1-carboxylic acid. InChIKey: CQINMZNDBYQHKR-PHDIDXHHSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | (1R,6R)-6-aminocyclohex-3-ene-1-carboxylic acid |
| InChIKey | CQINMZNDBYQHKR-PHDIDXHHSA-N |
| SMILES | C1C=CC[C@H]([C@@H]1C(=O)O)N |
Computed by PubChem (NCBI)