CAS 97997-76-7 appears in our catalog under these names: 2,4,5,6-Tetramethylbenzenedisulfonyl dichloride, 95%, 2,4,5,6-Tetramethylbenzene-1,3-disulfonyl dichloride, 98%, 2,4,5,6–Tetramethylbenzenedisulfonyl Dichloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 10g.
2,4,5,6-tetramethylbenzene-1,3-disulfonyl chloride (CAS 97997-76-7) is a chemical compound with the molecular formula C10H12Cl2O4S2 and a molecular weight of 331.2 g/mol. IUPAC name: 2,4,5,6-tetramethylbenzene-1,3-disulfonyl chloride. InChIKey: YEYQIYAYJJXKFB-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O4S2 |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | 2,4,5,6-tetramethylbenzene-1,3-disulfonyl chloride |
| InChIKey | YEYQIYAYJJXKFB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)S(=O)(=O)Cl)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)