CAS 98-14-6 appears in our catalog under these names: (4-Hydroxyphenyl)arsonic acid, 98%(T), 98%(T), 4-Hydroxyphenylarsonic Acid, >95% (HPLC), 4–Hydroxyphenylarsonic Acid, 4-Hydroxyphenylarsonic Acid, >98.0%(T). Offered by: Chemat, TRC, GLPBio, TCI. Available pack sizes: 1g, 5g, 2,5g, 250mg, 500mg, 25g.
(4-hydroxyphenyl)arsonic acid (CAS 98-14-6) is a chemical compound with the molecular formula C6H7AsO4 and a molecular weight of 218.04 g/mol. IUPAC name: (4-hydroxyphenyl)arsonic acid. InChIKey: RSRFURJMCNJVOW-UHFFFAOYSA-N.
| Molecular formula | C6H7AsO4 |
|---|---|
| Molecular weight | 218.04 g/mol |
| IUPAC name | (4-hydroxyphenyl)arsonic acid |
| InChIKey | RSRFURJMCNJVOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)[As](=O)(O)O |
Computed by PubChem (NCBI)