CAS 698-26-0 appears in our catalog under these names: 1H-Indazole, 5-chloro-, 98%, 98%, 5-Chloro-1H-indazole 98%, 5-Chloro-1H-indazole, 98%, N-(3-Bromophenyl)-2-methylpentanamide, 98%, 2,2′-Thiobis[4-(1,1-dimethylpropyl)phenol], 95%+, 95%+. Offered by: Chemat, Ambeed, Fluorochem, Chemat Brand. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
2-[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]sulfanyl-4-(2-methylbutan-2-yl)phenol (CAS 98-26-0) is a chemical compound with the molecular formula C22H30O2S and a molecular weight of 358.5 g/mol. IUPAC name: 2-[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]sulfanyl-4-(2-methylbutan-2-yl)phenol. InChIKey: JEBLAEFSCWNZMT-UHFFFAOYSA-N.
| Molecular formula | C22H30O2S |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | 2-[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]sulfanyl-4-(2-methylbutan-2-yl)phenol |
| InChIKey | JEBLAEFSCWNZMT-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C=C1)O)SC2=C(C=CC(=C2)C(C)(C)CC)O |
Computed by PubChem (NCBI)