CAS 98021-55-7 is the registry number for 5,5'-Methylenebis(1,3,4-thiadiazol-2-amine), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-1,3,4-thiadiazol-2-amine (CAS 98021-55-7) is a chemical compound with the molecular formula C5H6N6S2 and a molecular weight of 214.3 g/mol. IUPAC name: 5-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: SQOAJXDSPWAGRN-UHFFFAOYSA-N.
| Molecular formula | C5H6N6S2 |
|---|---|
| Molecular weight | 214.3 g/mol |
| IUPAC name | 5-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | SQOAJXDSPWAGRN-UHFFFAOYSA-N |
| SMILES | C(C1=NN=C(S1)N)C2=NN=C(S2)N |
Computed by PubChem (NCBI)