Products 98027-38-4
CAS 98027-38-4 appears in our catalog under these names: 4-Amino-2-chloropyrimidine-5-carboxamide 97%, 4-Amino-2-chloropyrimidine-5-carboxamide, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-amino-2-chloropyrimidine-5-carboxamide (CAS 98027-38-4) is a chemical compound with the molecular formula C5H5ClN4O and a molecular weight of 172.57 g/mol. IUPAC name: 4-amino-2-chloropyrimidine-5-carboxamide. InChIKey: SEQWNBBMRHGRPX-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN4O |
|---|---|
| Molecular weight | 172.57 g/mol |
| IUPAC name | 4-amino-2-chloropyrimidine-5-carboxamide |
| InChIKey | SEQWNBBMRHGRPX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)N)C(=O)N |
Computed by PubChem (NCBI)