CAS 98057-08-0 appears in our catalog under these names: 5,5''-Dibromo-2,2':5',2''-terthiophene, 95%, 5,5''–Dibromo–2,2':5',2''–terthiophene, 5,5''-Dibromo-2,2':5',2''-terthiophene, >97.0%(GC), 5,5''-Dibromo-2,2':5',2''-terthiophene, 98%, 5,5''-Dibromo-2,2':5',2''-terthiophene, 98% (stabilized with Cu+HQ+MgO). Offered by: Combi-blocks, GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 2.5g.
2,5-bis(5-bromothiophen-2-yl)thiophene (CAS 98057-08-0) is a chemical compound with the molecular formula C12H6Br2S3 and a molecular weight of 406.2 g/mol. IUPAC name: 2,5-bis(5-bromothiophen-2-yl)thiophene. InChIKey: KXFPYYJGYVYXIB-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2S3 |
|---|---|
| Molecular weight | 406.2 g/mol |
| IUPAC name | 2,5-bis(5-bromothiophen-2-yl)thiophene |
| InChIKey | KXFPYYJGYVYXIB-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C2=CC=C(S2)Br)C3=CC=C(S3)Br |
Computed by PubChem (NCBI)