Products 98102-32-0
CAS 98102-32-0 appears in our catalog under these names: H-Glu(OtBu)-OBzl.HCl, H-Glu(OtBu)-OBzl.HCl, 98%, 98%, (S)-1-Benzyl 5-tert-butyl 2-aminopentanedioate hydrochloride, 98%, H-Glu(OtBu)-OBzl·HCl, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g, 100g.
1-O-benzyl 5-O-tert-butyl (2S)-2-aminopentanedioate;hydrochloride (CAS 98102-32-0) is a chemical compound with the molecular formula C16H24ClNO4 and a molecular weight of 329.82 g/mol. IUPAC name: 1-O-benzyl 5-O-tert-butyl (2S)-2-aminopentanedioate;hydrochloride. InChIKey: PZCDXXIAXZLMQY-ZOWNYOTGSA-N.
| Molecular formula | C16H24ClNO4 |
|---|---|
| Molecular weight | 329.82 g/mol |
| IUPAC name | 1-O-benzyl 5-O-tert-butyl (2S)-2-aminopentanedioate;hydrochloride |
| InChIKey | PZCDXXIAXZLMQY-ZOWNYOTGSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-O-benzyl 5-O-tert-butyl (2S)-2-aminopentanedioate;hydrochloride, H-Glu(OtBu)-OBzl.HCl, (S)-1-Benzyl 5-tert-butyl 2-aminopentanedioate hydrochloride, H-Glu(OtBu)-Obzl HCl, L-Glu(OtBu)-OBzl.HCl, H-Glu(OtBu)-OBzl.HCl USP/EP/BP, 1-benzyl 5-(tert-butyl) L-glutamate hydrochloride, L-Glutamic acid 5-tert-butyl 1-benzyl ester HCl, L-glutamic acid-1-benzyl ester-5-tert-butyl ester, (S)-1-Benzyl 5-tert-butyl 2-aminopentanedioate HCl