CAS 98119-89-2 is the registry number for 2-Nitro-1,3-bis(phenylthio)benzene. Offered by: TRC. Available pack sizes: 1g, 2,5g, 250mg.
2-nitro-1,3-bis(phenylsulfanyl)benzene (CAS 98119-89-2) is a chemical compound with the molecular formula C18H13NO2S2 and a molecular weight of 339.4 g/mol. IUPAC name: 2-nitro-1,3-bis(phenylsulfanyl)benzene. InChIKey: GOMALWQZYLKPKP-UHFFFAOYSA-N.
| Molecular formula | C18H13NO2S2 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 2-nitro-1,3-bis(phenylsulfanyl)benzene |
| InChIKey | GOMALWQZYLKPKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=C(C(=CC=C2)SC3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)