CAS 98137-71-4 is the registry number for Sodium 2-(2-hydroxypropanamido)ethane-1-sulfonate. Offered by: TRC. Available pack sizes: 500mg.
Sodium 2-(2-hydroxypropanoylamino)ethanesulfonate (CAS 98137-71-4) is a chemical compound with the molecular formula C5H10NNaO5S and a molecular weight of 219.19 g/mol. IUPAC name: sodium 2-(2-hydroxypropanoylamino)ethanesulfonate. InChIKey: PIGVQNHWXQOCAD-UHFFFAOYSA-M.
| Molecular formula | C5H10NNaO5S |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | sodium 2-(2-hydroxypropanoylamino)ethanesulfonate |
| InChIKey | PIGVQNHWXQOCAD-UHFFFAOYSA-M |
| SMILES | CC(C(=O)NCCS(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)