Products 98181-86-3

CAS 98181-86-3 appears in our catalog under these names: 1-Fluoro-N,N,N-trimethylmethanaminium chloride 95%, 1-Fluoro-N,N,N-trimethylmethanaminium chloride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Fluoromethyl(trimethyl)azanium chloride (CAS 98181-86-3) is a chemical compound with the molecular formula C4H11ClFN and a molecular weight of 127.59 g/mol. IUPAC name: fluoromethyl(trimethyl)azanium chloride. InChIKey: CHPZCTVKYQNIRD-UHFFFAOYSA-M.

Identity
Molecular formulaC4H11ClFN
Molecular weight127.59 g/mol
IUPAC namefluoromethyl(trimethyl)azanium chloride
InChIKeyCHPZCTVKYQNIRD-UHFFFAOYSA-M
SMILESC[N+](C)(C)CF.[Cl-]

Computed by PubChem (NCBI)