CAS 98195-42-7 appears in our catalog under these names: 1-Bromoheptane-d15, 98 atom % D, min 98% Chemical Purity, 1-Bromoheptane-d15, 99.2%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10 mg, 25 mg, 50 mg.
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptane (CAS 98195-42-7) is a chemical compound with the molecular formula C7H15Br and a molecular weight of 194.19 g/mol. IUPAC name: 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptane. InChIKey: LSXKDWGTSHCFPP-PMELWRBQSA-N.
| Molecular formula | C7H15Br |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecadeuterioheptane |
| InChIKey | LSXKDWGTSHCFPP-PMELWRBQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)