CAS 98264-26-7 appears in our catalog under these names: 3,3,9,9-Tetraisopropyl-2,10-dimethyl-4,8-dioxa-3,9-disilaundecan-6-ol, 98%, 1,3-O-Bis(triisopropylsilyl) Glycerol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g, 25g, 5g.
1,3-bis[tri(propan-2-yl)silyloxy]propan-2-ol (CAS 98264-26-7) is a chemical compound with the molecular formula C21H48O3Si2 and a molecular weight of 404.8 g/mol. IUPAC name: 1,3-bis[tri(propan-2-yl)silyloxy]propan-2-ol. InChIKey: AWWCRMADSGPACI-UHFFFAOYSA-N.
| Molecular formula | C21H48O3Si2 |
|---|---|
| Molecular weight | 404.8 g/mol |
| IUPAC name | 1,3-bis[tri(propan-2-yl)silyloxy]propan-2-ol |
| InChIKey | AWWCRMADSGPACI-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)OCC(CO[Si](C(C)C)(C(C)C)C(C)C)O |
Computed by PubChem (NCBI)