CAS 983-30-2 appears in our catalog under these names: Estradiol Benzoate Impurity 4 (Estradiol Benzoate EP Impurity D), 3-Hydroxyestra-1,3,5(10)-trien-17beta-yl Benzoate (Estradiol 17-Benzoate), Estradiol benzoate impurity 1. Offered by: Hubei YoungXin, Mikromol, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] benzoate (CAS 983-30-2) is a chemical compound with the molecular formula C25H28O3 and a molecular weight of 376.5 g/mol. IUPAC name: [(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] benzoate. InChIKey: AAGOOGMSOHOVSE-BZDYCCQFSA-N.
| Molecular formula | C25H28O3 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] benzoate |
| InChIKey | AAGOOGMSOHOVSE-BZDYCCQFSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)C4=CC=CC=C4)CCC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)