CAS 98329-02-3 is the registry number for 1,3,5-tris(3,4-dichlorophenyl)-1,3,5-triazinane-2,4,6-trione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3,5-tris(3,4-dichlorophenyl)-1,3,5-triazinane-2,4,6-trione (CAS 98329-02-3) is a chemical compound with the molecular formula C21H9Cl6N3O3 and a molecular weight of 564.0 g/mol. IUPAC name: 1,3,5-tris(3,4-dichlorophenyl)-1,3,5-triazinane-2,4,6-trione. InChIKey: FXOQGHKORJYZFD-UHFFFAOYSA-N.
| Molecular formula | C21H9Cl6N3O3 |
|---|---|
| Molecular weight | 564.0 g/mol |
| IUPAC name | 1,3,5-tris(3,4-dichlorophenyl)-1,3,5-triazinane-2,4,6-trione |
| InChIKey | FXOQGHKORJYZFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)N(C(=O)N(C2=O)C3=CC(=C(C=C3)Cl)Cl)C4=CC(=C(C=C4)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)