Products 98374-54-0
CAS 98374-54-0 is the registry number for Siltenzepine. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, 50mg, 25mg, Get quote.
11-[2-[bis(2-hydroxyethyl)amino]acetyl]-3-chloro-5H-benzo[b][1,4]benzodiazepin-6-one (CAS 98374-54-0) is a chemical compound with the molecular formula C19H20ClN3O4 and a molecular weight of 389.8 g/mol. IUPAC name: 11-[2-[bis(2-hydroxyethyl)amino]acetyl]-3-chloro-5H-benzo[b][1,4]benzodiazepin-6-one. InChIKey: DDBKYWMANNIJRH-UHFFFAOYSA-N.
| Molecular formula | C19H20ClN3O4 |
|---|---|
| Molecular weight | 389.8 g/mol |
| IUPAC name | 11-[2-[bis(2-hydroxyethyl)amino]acetyl]-3-chloro-5H-benzo[b][1,4]benzodiazepin-6-one |
| InChIKey | DDBKYWMANNIJRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(N2C(=O)CN(CCO)CCO)C=CC(=C3)Cl |
Computed by PubChem (NCBI)