CAS 98389-46-9 appears in our catalog under these names: 1,4-Dimethyl-1H-pyrazole-5-sulfonamide, 97%, 1,4-Dimethyl-1H-pyrazole-5-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,4-dimethylpyrazole-5-sulfonamide (CAS 98389-46-9) is a chemical compound with the molecular formula C5H9N3O2S and a molecular weight of 175.21 g/mol. IUPAC name: 1,4-dimethylpyrazole-5-sulfonamide. InChIKey: CWPSQFBIFFEQHT-UHFFFAOYSA-N.
| Molecular formula | C5H9N3O2S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | 1,4-dimethylpyrazole-5-sulfonamide |
| InChIKey | CWPSQFBIFFEQHT-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1)C)S(=O)(=O)N |
Computed by PubChem (NCBI)