Products 98394-38-8
CAS 98394-38-8 is the registry number for γ-Kainylglutamic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[2-[(3S,4S)-2-carboxy-4-prop-1-en-2-ylpyrrolidin-3-yl]acetyl]amino]pentanedioic acid (CAS 98394-38-8) is a chemical compound with the molecular formula C15H22N2O7 and a molecular weight of 342.34 g/mol. IUPAC name: 2-[[2-[(3S,4S)-2-carboxy-4-prop-1-en-2-ylpyrrolidin-3-yl]acetyl]amino]pentanedioic acid. InChIKey: KRCXEEUOPUTIDN-DFWJVEDMSA-N.
| Molecular formula | C15H22N2O7 |
|---|---|
| Molecular weight | 342.34 g/mol |
| IUPAC name | 2-[[2-[(3S,4S)-2-carboxy-4-prop-1-en-2-ylpyrrolidin-3-yl]acetyl]amino]pentanedioic acid |
| InChIKey | KRCXEEUOPUTIDN-DFWJVEDMSA-N |
| SMILES | CC(=C)[C@H]1CNC([C@H]1CC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)