CAS 98437-13-9 is the registry number for 2-Amino-6-(methylthio)pyridine-3,5-dicarbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-6-methylsulfanylpyridine-3,5-dicarbonitrile (CAS 98437-13-9) is a chemical compound with the molecular formula C8H6N4S and a molecular weight of 190.23 g/mol. IUPAC name: 2-amino-6-methylsulfanylpyridine-3,5-dicarbonitrile. InChIKey: MNDACYDFCGIUAF-UHFFFAOYSA-N.
| Molecular formula | C8H6N4S |
|---|---|
| Molecular weight | 190.23 g/mol |
| IUPAC name | 2-amino-6-methylsulfanylpyridine-3,5-dicarbonitrile |
| InChIKey | MNDACYDFCGIUAF-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C(=N1)N)C#N)C#N |
Computed by PubChem (NCBI)