CAS 98452-82-5 is the registry number for Bis(hexafluoroisopropyl)itaconate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-methylidenebutanedioate (CAS 98452-82-5) is a chemical compound with the molecular formula C11H6F12O4 and a molecular weight of 430.14 g/mol. IUPAC name: bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-methylidenebutanedioate. InChIKey: OICRDFIVTSEVJJ-UHFFFAOYSA-N.
| Molecular formula | C11H6F12O4 |
|---|---|
| Molecular weight | 430.14 g/mol |
| IUPAC name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) 2-methylidenebutanedioate |
| InChIKey | OICRDFIVTSEVJJ-UHFFFAOYSA-N |
| SMILES | C=C(CC(=O)OC(C(F)(F)F)C(F)(F)F)C(=O)OC(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)