Products 98469-29-5

CAS 98469-29-5 is the registry number for Di-Boc-2,6-diaminoheptanedioic Acid (Mixture of Isomers). Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]heptanedioic acid (CAS 98469-29-5) is a chemical compound with the molecular formula C17H30N2O8 and a molecular weight of 390.4 g/mol. IUPAC name: 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]heptanedioic acid. InChIKey: UDAZYQMVLYCKHG-UHFFFAOYSA-N.

Identity
Molecular formulaC17H30N2O8
Molecular weight390.4 g/mol
IUPAC name2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]heptanedioic acid
InChIKeyUDAZYQMVLYCKHG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CCCC(C(=O)O)NC(=O)OC(C)(C)C)C(=O)O

Computed by PubChem (NCBI)