Products 98502-96-6

CAS 98502-96-6 is the registry number for Acipimox Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-1-oxidopyrazin-1-ium-2-carboxylic acid (CAS 98502-96-6) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 5-methyl-1-oxidopyrazin-1-ium-2-carboxylic acid. InChIKey: CLXREMDHRROEST-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O3
Molecular weight154.12 g/mol
IUPAC name5-methyl-1-oxidopyrazin-1-ium-2-carboxylic acid
InChIKeyCLXREMDHRROEST-UHFFFAOYSA-N
SMILESCC1=NC=C([N+](=C1)[O-])C(=O)O

Computed by PubChem (NCBI)