Products 98518-48-0
CAS 98518-48-0 is the registry number for Ifoxetine (hemisulfate). Offered by: MedChemExpress. Available pack sizes: Get quote.
Bis((3R,4S)-4-(3,4-dimethylphenoxy)piperidin-3-ol);sulfuric acid (CAS 98518-48-0) is a chemical compound with the molecular formula C26H40N2O8S and a molecular weight of 540.7 g/mol. IUPAC name: bis((3R,4S)-4-(3,4-dimethylphenoxy)piperidin-3-ol);sulfuric acid. InChIKey: MJQRJFLTDXDFSO-NVGTXZLJSA-N.
| Molecular formula | C26H40N2O8S |
|---|---|
| Molecular weight | 540.7 g/mol |
| IUPAC name | bis((3R,4S)-4-(3,4-dimethylphenoxy)piperidin-3-ol);sulfuric acid |
| InChIKey | MJQRJFLTDXDFSO-NVGTXZLJSA-N |
| SMILES | CC1=C(C=C(C=C1)O[C@H]2CCNC[C@H]2O)C.CC1=C(C=C(C=C1)O[C@H]2CCNC[C@H]2O)C.OS(=O)(=O)O |
Computed by PubChem (NCBI)