CAS 98534-80-6 appears in our catalog under these names: 2-(4-Chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylic acid, 95%, 1-(4-Chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 97%, 1-(4-Chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 10g, 25g, 250mg, 500mg, 5g.
1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 98534-80-6) is a chemical compound with the molecular formula C11H6ClF3N2O2 and a molecular weight of 290.62 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: HSZJMDBOSZVDOK-UHFFFAOYSA-N.
| Molecular formula | C11H6ClF3N2O2 |
|---|---|
| Molecular weight | 290.62 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | HSZJMDBOSZVDOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C(C=N2)C(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)