CAS 98592-15-5 is the registry number for 5-(4-Bromophenyl)-1,2,4-triazine-3-thiol. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-(4-bromophenyl)-2H-1,2,4-triazine-3-thione (CAS 98592-15-5) is a chemical compound with the molecular formula C9H6BrN3S and a molecular weight of 268.14 g/mol. IUPAC name: 5-(4-bromophenyl)-2H-1,2,4-triazine-3-thione. InChIKey: DYPGGEKUMWYGTI-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3S |
|---|---|
| Molecular weight | 268.14 g/mol |
| IUPAC name | 5-(4-bromophenyl)-2H-1,2,4-triazine-3-thione |
| InChIKey | DYPGGEKUMWYGTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=S)NN=C2)Br |
Computed by PubChem (NCBI)