CAS 98594-62-8 appears in our catalog under these names: ((4-Sulfamoylphenyl)methyl)thiourea, 95%, ((4-Sulfamoylphenyl)methyl)thiourea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(4-sulfamoylphenyl)methylthiourea (CAS 98594-62-8) is a chemical compound with the molecular formula C8H11N3O2S2 and a molecular weight of 245.3 g/mol. IUPAC name: (4-sulfamoylphenyl)methylthiourea. InChIKey: URAFIWIDRJBACC-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2S2 |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | (4-sulfamoylphenyl)methylthiourea |
| InChIKey | URAFIWIDRJBACC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=S)N)S(=O)(=O)N |
Computed by PubChem (NCBI)