CAS 98600-74-9 is the registry number for Procarbazine-d3. Offered by: Chemat Brand. Available pack sizes: on request.
N-propan-2-yl-4-[[2-(trideuteriomethyl)hydrazinyl]methyl]benzamide (CAS 98600-74-9) is a chemical compound with the molecular formula C12H19N3O and a molecular weight of 224.32 g/mol. IUPAC name: N-propan-2-yl-4-[[2-(trideuteriomethyl)hydrazinyl]methyl]benzamide. InChIKey: CPTBDICYNRMXFX-HPRDVNIFSA-N.
| Molecular formula | C12H19N3O |
|---|---|
| Molecular weight | 224.32 g/mol |
| IUPAC name | N-propan-2-yl-4-[[2-(trideuteriomethyl)hydrazinyl]methyl]benzamide |
| InChIKey | CPTBDICYNRMXFX-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])NNCC1=CC=C(C=C1)C(=O)NC(C)C |
Computed by PubChem (NCBI)