CAS 98636-73-8 appears in our catalog under these names: Nitrocaramiphen hydrochloride/ 98.94% (existing batch purity), Nitrocaramiphen hydrochloride, 2-(Diethylamino)ethyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate hydrochloride, ≥98%(HPLC), ≥98%(HPLC), Nitrocaramiphen (hydrochloride), 99.62%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg, 25 mg.
2-(diethylamino)ethyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride (CAS 98636-73-8) is a chemical compound with the molecular formula C18H27ClN2O4 and a molecular weight of 370.9 g/mol. IUPAC name: 2-(diethylamino)ethyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride. InChIKey: XWQWACGTGFICFO-UHFFFAOYSA-N.
| Molecular formula | C18H27ClN2O4 |
|---|---|
| Molecular weight | 370.9 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride |
| InChIKey | XWQWACGTGFICFO-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C1(CCCC1)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)