CAS 98705-91-0 is the registry number for Acid Orange 5 Potassium Salt. Offered by: TRC. Available pack sizes: 1g, 500mg, 5g.
Potassium 4-[(4-anilinophenyl)diazenyl]benzenesulfonate (CAS 98705-91-0) is a chemical compound with the molecular formula C18H14KN3O3S and a molecular weight of 391.5 g/mol. IUPAC name: potassium 4-[(4-anilinophenyl)diazenyl]benzenesulfonate. InChIKey: NRTSVDGJEXDEGX-UHFFFAOYSA-M.
| Molecular formula | C18H14KN3O3S |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | potassium 4-[(4-anilinophenyl)diazenyl]benzenesulfonate |
| InChIKey | NRTSVDGJEXDEGX-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N=NC3=CC=C(C=C3)S(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)