CAS 98778-71-3 appears in our catalog under these names: (2S,5S)-2,5-Dimethylpiperazine dihydrobromide, 95%, (2S,5S)-2,5-Dimethylpiperazine dihydrobromide, 97%, (2S,5S)-2,5-Dimethylpiperazine dihydrobromide, 97%, 97%, (2S,5S)-2,5-DIMETHYL-PIPERAZINE 2HBR, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
(2S,5S)-2,5-dimethylpiperazine;dihydrobromide (CAS 98778-71-3) is a chemical compound with the molecular formula C6H16Br2N2 and a molecular weight of 276.01 g/mol. IUPAC name: (2S,5S)-2,5-dimethylpiperazine;dihydrobromide. InChIKey: CHGBTPQJPVPJJP-USPAICOZSA-N.
| Molecular formula | C6H16Br2N2 |
|---|---|
| Molecular weight | 276.01 g/mol |
| IUPAC name | (2S,5S)-2,5-dimethylpiperazine;dihydrobromide |
| InChIKey | CHGBTPQJPVPJJP-USPAICOZSA-N |
| SMILES | C[C@H]1CN[C@H](CN1)C.Br.Br |
Computed by PubChem (NCBI)