CAS 98819-68-2 is the registry number for ((2R,3R)-3-Phenyloxiran-2-yl)methanol, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R)-3-phenyloxiran-2-yl]methanol (CAS 98819-68-2) is a chemical compound with the molecular formula C9H10O2 and a molecular weight of 150.17 g/mol. IUPAC name: [(2R,3R)-3-phenyloxiran-2-yl]methanol. InChIKey: PVALSANGMFRTQM-RKDXNWHRSA-N.
| Molecular formula | C9H10O2 |
|---|---|
| Molecular weight | 150.17 g/mol |
| IUPAC name | [(2R,3R)-3-phenyloxiran-2-yl]methanol |
| InChIKey | PVALSANGMFRTQM-RKDXNWHRSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]2[C@H](O2)CO |
Computed by PubChem (NCBI)