CAS 98837-98-0 is the registry number for Bis(trifluoromethanesulfonyl)imide anion, 99%, 99%. Offered by: Chemat. Available pack sizes: 5g, 10g, 25g.
Bistriflylimide anion is an imide anion in which the substituents on the negatively charged nitrogen are triflyl groups.
Source: ChEBI
| Molecular formula | C2F6NO4S2- |
|---|---|
| Molecular weight | 280.15 g/mol |
| IUPAC name | bis(trifluoromethylsulfonyl)azanide |
| InChIKey | NHHWJSXMTZIPES-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)