CAS 98854-91-2 appears in our catalog under these names: Z-D-Alpha-vinyl-gly-ome, 95%, (R)-Methyl 2-(((benzyloxy)carbonyl)amino)but-3-enoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
Methyl (2R)-2-(phenylmethoxycarbonylamino)but-3-enoate (CAS 98854-91-2) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: methyl (2R)-2-(phenylmethoxycarbonylamino)but-3-enoate. InChIKey: YDGRSOXTMWVLOJ-LLVKDONJSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | methyl (2R)-2-(phenylmethoxycarbonylamino)but-3-enoate |
| InChIKey | YDGRSOXTMWVLOJ-LLVKDONJSA-N |
| SMILES | COC(=O)[C@@H](C=C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)