CAS 98879-90-4 is the registry number for 1,3-Dimethyl-2,4,7-trioxo-1,2,3,4,7,8-hexahydropteridine-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylic acid (CAS 98879-90-4) is a chemical compound with the molecular formula C9H8N4O5 and a molecular weight of 252.18 g/mol. IUPAC name: 1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylic acid. InChIKey: HXXQJEUEICLLLJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O5 |
|---|---|
| Molecular weight | 252.18 g/mol |
| IUPAC name | 1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylic acid |
| InChIKey | HXXQJEUEICLLLJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)