Products 98879-90-4

CAS 98879-90-4 is the registry number for 1,3-Dimethyl-2,4,7-trioxo-1,2,3,4,7,8-hexahydropteridine-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylic acid (CAS 98879-90-4) is a chemical compound with the molecular formula C9H8N4O5 and a molecular weight of 252.18 g/mol. IUPAC name: 1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylic acid. InChIKey: HXXQJEUEICLLLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N4O5
Molecular weight252.18 g/mol
IUPAC name1,3-dimethyl-2,4,7-trioxo-8H-pteridine-6-carboxylic acid
InChIKeyHXXQJEUEICLLLJ-UHFFFAOYSA-N
SMILESCN1C2=C(C(=O)N(C1=O)C)N=C(C(=O)N2)C(=O)O

Computed by PubChem (NCBI)