Products 98890-01-8
CAS 98890-01-8 is the registry number for Griseolic acid B. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-aminopurin-9-yl)-5-(carboxymethyl)-3-hydroxy-3,3a-dihydro-2H-furo[3,2-b]furan-5-carboxylic acid (CAS 98890-01-8) is a chemical compound with the molecular formula C14H13N5O7 and a molecular weight of 363.28 g/mol. IUPAC name: 2-(6-aminopurin-9-yl)-5-(carboxymethyl)-3-hydroxy-3,3a-dihydro-2H-furo[3,2-b]furan-5-carboxylic acid. InChIKey: WRHIKWNGCJVUOW-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O7 |
|---|---|
| Molecular weight | 363.28 g/mol |
| IUPAC name | 2-(6-aminopurin-9-yl)-5-(carboxymethyl)-3-hydroxy-3,3a-dihydro-2H-furo[3,2-b]furan-5-carboxylic acid |
| InChIKey | WRHIKWNGCJVUOW-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(C(O2)N3C=NC4=C(N=CN=C43)N)O)OC1(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)