CAS 699-12-7 appears in our catalog under these names: 2-(PHENYLTHIO)ETHANOL, 99%, 3,5-Dimethylnitrobenzene, >98.0%(GC). Offered by: Sigma-Aldrich, TCI. Available pack sizes: 50G, 5g.
1,3-dimethyl-5-nitrobenzene (CAS 99-12-7) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 1,3-dimethyl-5-nitrobenzene. InChIKey: BYFNZOKBMZKTSC-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | 1,3-dimethyl-5-nitrobenzene |
| InChIKey | BYFNZOKBMZKTSC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)