CAS 99-26-3 appears in our catalog under these names: Bismuth subgallate, 95%, Bismuth Subgallate, BISMUTH SUBGALLATE/ 98.7% (existing batch purity), Bismuth subgallate, Bismuth(III) gallate basic hydrate, 52.00%. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 25g, 100g, 500g, 5g, on request, 10g, 1g, 500mg.
Bismuth;5-carboxy-3-hydroxybenzene-1,2-diolate;hydroxide (CAS 99-26-3) is a chemical compound with the molecular formula C7H5BiO6 and a molecular weight of 394.09 g/mol. IUPAC name: bismuth;5-carboxy-3-hydroxybenzene-1,2-diolate;hydroxide. InChIKey: JAONZGLTYYUPCT-UHFFFAOYSA-K.
| Molecular formula | C7H5BiO6 |
|---|---|
| Molecular weight | 394.09 g/mol |
| IUPAC name | bismuth;5-carboxy-3-hydroxybenzene-1,2-diolate;hydroxide |
| InChIKey | JAONZGLTYYUPCT-UHFFFAOYSA-K |
| SMILES | C1=C(C=C(C(=C1O)[O-])[O-])C(=O)O.[OH-].[Bi+3] |
Computed by PubChem (NCBI)