CAS 99-33-2 appears in our catalog under these names: 3,5-Dinitrobenzoyl chloride, 99%, 3,5-Dinitrobenzoyl Chloride, 3,5-Dinitrobenzoyl chloride, 98+% , 3,5-Dinitrobenzoyl Chloride [for HPLC Labeling], >99.0%(T), 3,5-Dinitrobenzoyl Chloride, >98.0%(GC)(T). Offered by: Thermo Scientific (Acros), TRC, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 100g, 500g, 0,05kg, 0,025kg, 5g, 0,1kg, 0,25kg.
3,5-dinitrobenzoyl chloride (CAS 99-33-2) is a chemical compound with the molecular formula C7H3ClN2O5 and a molecular weight of 230.56 g/mol. IUPAC name: 3,5-dinitrobenzoyl chloride. InChIKey: NNOHXABAQAGKRZ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O5 |
|---|---|
| Molecular weight | 230.56 g/mol |
| IUPAC name | 3,5-dinitrobenzoyl chloride |
| InChIKey | NNOHXABAQAGKRZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)